C14H24IN3OS — CID 111654373
1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(2-methylcyclopropyl)guanidine;hydroiodide (PubChem CID 111654373) has the molecular formula C14H24IN3OS and a molecular weight of 409.34 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(2-methylcyclopropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(2-methylcyclopropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111654373 |
| Molecular Formula | C14H24IN3OS |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(2-methylcyclopropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccsc1)NC1CC1C.I |
| InChI | InChI=1S/C14H23N3OS.HI/c1-4-15-13(17-12-7-10(12)2)16-9-14(3,18)11-5-6-19-8-11;/h5-6,8,10,12,18H,4,7,9H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | VTGBENXFJKOQKX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|