C16H26F3IN4OS — CID 111654747
1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111654747) has the molecular formula C16H26F3IN4OS and a molecular weight of 506.38 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111654747 |
| Molecular Formula | C16H26F3IN4OS |
| Molecular Weight | 506.38 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccsc1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C16H25F3N4OS.HI/c1-3-20-14(21-10-15(2,24)12-5-7-25-9-12)22-13-4-6-23(8-13)11-16(17,18)19;/h5,7,9,13,24H,3-4,6,8,10-11H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | LYKGXJAIKBZQLF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|