C18H30N4OS — CID 111654016
1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine (PubChem CID 111654016) has the molecular formula C18H30N4OS and a molecular weight of 350.53 g/mol. Its IUPAC name is 1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine.
| Compound Name | 1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111654016 |
| Molecular Formula | C18H30N4OS |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccsc1)NCC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C18H30N4OS/c1-3-19-17(21-13-18(2,23)15-7-9-24-12-15)20-10-14-6-8-22(11-14)16-4-5-16/h7,9,12,14,16,23H,3-6,8,10-11,13H2,1-2H3,(H2,19,20,21) |
| InChIKey | KFLUDPZGWUBXMX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|