C22H34IN7 — CID 119158378
1-(1-benzylpiperidin-3-yl)-2-methyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide (PubChem CID 119158378) has the molecular formula C22H34IN7 and a molecular weight of 523.47 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-3-yl)-2-methyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1-benzylpiperidin-3-yl)-2-methyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119158378 |
| Molecular Formula | C22H34IN7 |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 1-(1-benzylpiperidin-3-yl)-2-methyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCc2nnc(C)n2C1)NC1CCCN(Cc2ccccc2)C1.I |
| InChI | InChI=1S/C22H33N7.HI/c1-17-26-27-21-11-10-19(15-29(17)21)13-24-22(23-2)25-20-9-6-12-28(16-20)14-18-7-4-3-5-8-18;/h3-5,7-8,19-20H,6,9-16H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | LLJYWTCHQPTYLC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|