C25H31F2N5 — CID 111984431
1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine (PubChem CID 111984431) has the molecular formula C25H31F2N5 and a molecular weight of 439.55 g/mol. Its IUPAC name is 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine.
| Compound Name | 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111984431 |
| Molecular Formula | C25H31F2N5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-[3-(1H-indol-3-yl)propyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCc1c[nH]c2ccccc12)NC1CCN(Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C25H31F2N5/c1-28-25(29-12-4-5-19-16-30-24-7-3-2-6-21(19)24)31-20-10-13-32(14-11-20)17-18-8-9-22(26)23(27)15-18/h2-3,6-9,15-16,20,30H,4-5,10-14,17H2,1H3,(H2,28,29,31) |
| InChIKey | BZKXIMXJPIBIQB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|