C15H19NO3 — CID 58843105
methyl 3-(5-methoxy-1H-indol-3-yl)-2,2-dimethylpropanoate (PubChem CID 58843105) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is methyl 3-(5-methoxy-1H-indol-3-yl)-2,2-dimethylpropanoate.
| Compound Name | methyl 3-(5-methoxy-1H-indol-3-yl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58843105 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | methyl 3-(5-methoxy-1H-indol-3-yl)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)Cc1c[nH]c2ccc(OC)cc12 |
| InChI | InChI=1S/C15H19NO3/c1-15(2,14(17)19-4)8-10-9-16-13-6-5-11(18-3)7-12(10)13/h5-7,9,16H,8H2,1-4H3 |
| InChIKey | DDLSTAOYIWOSRY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |