C14H13F3N2O5 — CID 72683042
methyl 2-methyl-2-nitro-3-[5-(trifluoromethoxy)-1H-indol-3-yl]propanoate (PubChem CID 72683042) has the molecular formula C14H13F3N2O5 and a molecular weight of 346.26 g/mol. Its IUPAC name is methyl 2-methyl-2-nitro-3-[5-(trifluoromethoxy)-1H-indol-3-yl]propanoate.
| Compound Name | methyl 2-methyl-2-nitro-3-[5-(trifluoromethoxy)-1H-indol-3-yl]propanoate |
|---|---|
| PubChem CID | 72683042 |
| Molecular Formula | C14H13F3N2O5 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | methyl 2-methyl-2-nitro-3-[5-(trifluoromethoxy)-1H-indol-3-yl]propanoate |
| SMILES | COC(=O)C(C)(Cc1c[nH]c2ccc(OC(F)(F)F)cc12)[N+](=O)[O-] |
| InChI | InChI=1S/C14H13F3N2O5/c1-13(19(21)22,12(20)23-2)6-8-7-18-11-4-3-9(5-10(8)11)24-14(15,16)17/h3-5,7,18H,6H2,1-2H3 |
| InChIKey | ZULBCLHEVVIEHO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|