C16H20F2N2O3 — CID 90801911
ethyl 2-amino-2-[[5-(difluoromethoxy)-1H-indol-3-yl]methyl]butanoate (PubChem CID 90801911) has the molecular formula C16H20F2N2O3 and a molecular weight of 326.34 g/mol. Its IUPAC name is ethyl 2-amino-2-[[5-(difluoromethoxy)-1H-indol-3-yl]methyl]butanoate.
| Compound Name | ethyl 2-amino-2-[[5-(difluoromethoxy)-1H-indol-3-yl]methyl]butanoate |
|---|---|
| PubChem CID | 90801911 |
| Molecular Formula | C16H20F2N2O3 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | ethyl 2-amino-2-[[5-(difluoromethoxy)-1H-indol-3-yl]methyl]butanoate |
| SMILES | CCOC(=O)C(N)(CC)Cc1c[nH]c2ccc(OC(F)F)cc12 |
| InChI | InChI=1S/C16H20F2N2O3/c1-3-16(19,14(21)22-4-2)8-10-9-20-13-6-5-11(7-12(10)13)23-15(17)18/h5-7,9,15,20H,3-4,8,19H2,1-2H3 |
| InChIKey | RXZDDQNYCAPBAL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |