C25H40N2O5 — CID 54408761
ethyl (2S)-2-(diethoxymethyl)-2-ethyl-5-[2-(5-methoxy-1H-indol-3-yl)ethylamino]pentanoate (PubChem CID 54408761) has the molecular formula C25H40N2O5 and a molecular weight of 448.60 g/mol. Its IUPAC name is ethyl (2S)-2-(diethoxymethyl)-2-ethyl-5-[2-(5-methoxy-1H-indol-3-yl)ethylamino]pentanoate.
| Compound Name | ethyl (2S)-2-(diethoxymethyl)-2-ethyl-5-[2-(5-methoxy-1H-indol-3-yl)ethylamino]pentanoate |
|---|---|
| PubChem CID | 54408761 |
| Molecular Formula | C25H40N2O5 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | ethyl (2S)-2-(diethoxymethyl)-2-ethyl-5-[2-(5-methoxy-1H-indol-3-yl)ethylamino]pentanoate |
| SMILES | CCOC(=O)[C@@](CC)(CCCNCCc1c[nH]c2ccc(OC)cc12)C(OCC)OCC |
| InChI | InChI=1S/C25H40N2O5/c1-6-25(23(28)30-7-2,24(31-8-3)32-9-4)14-10-15-26-16-13-19-18-27-22-12-11-20(29-5)17-21(19)22/h11-12,17-18,24,26-27H,6-10,13-16H2,1-5H3/t25-/m1/s1 |
| InChIKey | VSPOYLAHAFWKOC-RUZDIDTESA-N |
| XLogP | 4.45 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|