C19H29N3O3 — CID 145466112
3-amino-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-oxohexanamide;ethane (PubChem CID 145466112) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-amino-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-oxohexanamide;ethane.
| Compound Name | 3-amino-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-oxohexanamide;ethane |
|---|---|
| PubChem CID | 145466112 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 3-amino-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-oxohexanamide;ethane |
| SMILES | CC.CCCC(N)C(=O)C(=O)NCCc1c[nH]c2ccc(OC)cc12 |
| InChI | InChI=1S/C17H23N3O3.C2H6/c1-3-4-14(18)16(21)17(22)19-8-7-11-10-20-15-6-5-12(23-2)9-13(11)15;1-2/h5-6,9-10,14,20H,3-4,7-8,18H2,1-2H3,(H,19,22);1-2H3 |
| InChIKey | LMLZRVQZBRFXLK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|