C14H18F2N2O2 — CID 176862192
2,2-dideuterio-2-(difluoromethoxy)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]ethanamine (PubChem CID 176862192) has the molecular formula C14H18F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 2,2-dideuterio-2-(difluoromethoxy)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]ethanamine.
| Compound Name | 2,2-dideuterio-2-(difluoromethoxy)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 176862192 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2,2-dideuterio-2-(difluoromethoxy)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]ethanamine |
| SMILES | [2H]C([2H])(CNCCc1c[nH]c2ccc(OC)cc12)OC(F)F |
| InChI | InChI=1S/C14H18F2N2O2/c1-19-11-2-3-13-12(8-11)10(9-18-13)4-5-17-6-7-20-14(15)16/h2-3,8-9,14,17-18H,4-7H2,1H3/i7D2 |
| InChIKey | ZBCRJUYJMLCOPS-RJSZUWSASA-N |
| XLogP | 2.55 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|