C12H12F3NO — CID 102104245
5-methoxy-3-(3,3,3-trifluoropropyl)-1H-indole (PubChem CID 102104245) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is 5-methoxy-3-(3,3,3-trifluoropropyl)-1H-indole.
| Compound Name | 5-methoxy-3-(3,3,3-trifluoropropyl)-1H-indole |
|---|---|
| PubChem CID | 102104245 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 5-methoxy-3-(3,3,3-trifluoropropyl)-1H-indole |
| SMILES | COc1ccc2[nH]cc(CCC(F)(F)F)c2c1 |
| InChI | InChI=1S/C12H12F3NO/c1-17-9-2-3-11-10(6-9)8(7-16-11)4-5-12(13,14)15/h2-3,6-7,16H,4-5H2,1H3 |
| InChIKey | AAPVIEPOHHMLDD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |