C13H19N3O — CID 19837016
4-(6-methoxy-1H-indol-3-yl)butane-2,2-diamine (PubChem CID 19837016) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-(6-methoxy-1H-indol-3-yl)butane-2,2-diamine.
| Compound Name | 4-(6-methoxy-1H-indol-3-yl)butane-2,2-diamine |
|---|---|
| PubChem CID | 19837016 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 4-(6-methoxy-1H-indol-3-yl)butane-2,2-diamine |
| SMILES | COc1ccc2c(CCC(C)(N)N)c[nH]c2c1 |
| InChI | InChI=1S/C13H19N3O/c1-13(14,15)6-5-9-8-16-12-7-10(17-2)3-4-11(9)12/h3-4,7-8,16H,5-6,14-15H2,1-2H3 |
| InChIKey | LVLMWACXLYHIHY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 77.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|