C18H21N3O — CID 143202760
1-N-[2-(6-methoxy-1H-indol-3-yl)ethyl]-2-methylbenzene-1,4-diamine (PubChem CID 143202760) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is 1-N-[2-(6-methoxy-1H-indol-3-yl)ethyl]-2-methylbenzene-1,4-diamine.
| Compound Name | 1-N-[2-(6-methoxy-1H-indol-3-yl)ethyl]-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 143202760 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 1-N-[2-(6-methoxy-1H-indol-3-yl)ethyl]-2-methylbenzene-1,4-diamine |
| SMILES | COc1ccc2c(CCNc3ccc(N)cc3C)c[nH]c2c1 |
| InChI | InChI=1S/C18H21N3O/c1-12-9-14(19)3-6-17(12)20-8-7-13-11-21-18-10-15(22-2)4-5-16(13)18/h3-6,9-11,20-21H,7-8,19H2,1-2H3 |
| InChIKey | GXJBOIRYDUCJAJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|