C18H21N3 — CID 59493253
2-methyl-1-N-[2-(7-methyl-1H-indol-3-yl)ethyl]benzene-1,4-diamine (PubChem CID 59493253) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is 2-methyl-1-N-[2-(7-methyl-1H-indol-3-yl)ethyl]benzene-1,4-diamine.
| Compound Name | 2-methyl-1-N-[2-(7-methyl-1H-indol-3-yl)ethyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 59493253 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 2-methyl-1-N-[2-(7-methyl-1H-indol-3-yl)ethyl]benzene-1,4-diamine |
| SMILES | Cc1cc(N)ccc1NCCc1c[nH]c2c(C)cccc12 |
| InChI | InChI=1S/C18H21N3/c1-12-4-3-5-16-14(11-21-18(12)16)8-9-20-17-7-6-15(19)10-13(17)2/h3-7,10-11,20-21H,8-9,19H2,1-2H3 |
| InChIKey | PPVPCEUPLSLFRG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|