C20H27N3 — CID 143759213
ethane;2-methyl-1-N-[2-(7-methyl-1H-indol-3-yl)ethyl]benzene-1,4-diamine (PubChem CID 143759213) has the molecular formula C20H27N3 and a molecular weight of 309.46 g/mol. Its IUPAC name is ethane;2-methyl-1-N-[2-(7-methyl-1H-indol-3-yl)ethyl]benzene-1,4-diamine.
| Compound Name | ethane;2-methyl-1-N-[2-(7-methyl-1H-indol-3-yl)ethyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 143759213 |
| Molecular Formula | C20H27N3 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | ethane;2-methyl-1-N-[2-(7-methyl-1H-indol-3-yl)ethyl]benzene-1,4-diamine |
| SMILES | CC.Cc1cc(N)ccc1NCCc1c[nH]c2c(C)cccc12 |
| InChI | InChI=1S/C18H21N3.C2H6/c1-12-4-3-5-16-14(11-21-18(12)16)8-9-20-17-7-6-15(19)10-13(17)2;1-2/h3-7,10-11,20-21H,8-9,19H2,1-2H3;1-2H3 |
| InChIKey | WEYRLALTSYLXCI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|