C13H16N2O — CID 61469783
1-N-[2-(furan-2-yl)ethyl]-2-methylbenzene-1,4-diamine (PubChem CID 61469783) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-N-[2-(furan-2-yl)ethyl]-2-methylbenzene-1,4-diamine.
| Compound Name | 1-N-[2-(furan-2-yl)ethyl]-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 61469783 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-N-[2-(furan-2-yl)ethyl]-2-methylbenzene-1,4-diamine |
| SMILES | Cc1cc(N)ccc1NCCc1ccco1 |
| InChI | InChI=1S/C13H16N2O/c1-10-9-11(14)4-5-13(10)15-7-6-12-3-2-8-16-12/h2-5,8-9,15H,6-7,14H2,1H3 |
| InChIKey | SWUWVADXXPQUHX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|