C12H14N2O — CID 61469743
3-N-[2-(furan-2-yl)ethyl]benzene-1,3-diamine (PubChem CID 61469743) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-N-[2-(furan-2-yl)ethyl]benzene-1,3-diamine.
| Compound Name | 3-N-[2-(furan-2-yl)ethyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 61469743 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3-N-[2-(furan-2-yl)ethyl]benzene-1,3-diamine |
| SMILES | Nc1cccc(NCCc2ccco2)c1 |
| InChI | InChI=1S/C12H14N2O/c13-10-3-1-4-11(9-10)14-7-6-12-5-2-8-15-12/h1-5,8-9,14H,6-7,13H2 |
| InChIKey | YOMHZBRYUQSAOJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|