C15H16N2O2 — CID 115342852
(E)-3-(3-aminophenyl)-N-[2-(furan-2-yl)ethyl]prop-2-enamide (PubChem CID 115342852) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is (E)-3-(3-aminophenyl)-N-[2-(furan-2-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-aminophenyl)-N-[2-(furan-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 115342852 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (E)-3-(3-aminophenyl)-N-[2-(furan-2-yl)ethyl]prop-2-enamide |
| SMILES | Nc1cccc(/C=C/C(=O)NCCc2ccco2)c1 |
| InChI | InChI=1S/C15H16N2O2/c16-13-4-1-3-12(11-13)6-7-15(18)17-9-8-14-5-2-10-19-14/h1-7,10-11H,8-9,16H2,(H,17,18)/b7-6+ |
| InChIKey | VIGAKUUZIRDZAY-VOTSOKGWSA-N |
| XLogP | 2.23 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|