C14H17N5O — CID 115344130
(E)-3-(3-aminophenyl)-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide (PubChem CID 115344130) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is (E)-3-(3-aminophenyl)-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-aminophenyl)-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 115344130 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (E)-3-(3-aminophenyl)-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide |
| SMILES | Cn1cnnc1CCNC(=O)/C=C/c1cccc(N)c1 |
| InChI | InChI=1S/C14H17N5O/c1-19-10-17-18-13(19)7-8-16-14(20)6-5-11-3-2-4-12(15)9-11/h2-6,9-10H,7-8,15H2,1H3,(H,16,20)/b6-5+ |
| InChIKey | FYRXEHLINFSHAZ-AATRIKPKSA-N |
| XLogP | 0.77 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|