C15H17N3OS — CID 106047459
(E)-3-(3-aminophenyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]prop-2-enamide (PubChem CID 106047459) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is (E)-3-(3-aminophenyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-aminophenyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 106047459 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (E)-3-(3-aminophenyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]prop-2-enamide |
| SMILES | Cc1nc(CCNC(=O)/C=C/c2cccc(N)c2)cs1 |
| InChI | InChI=1S/C15H17N3OS/c1-11-18-14(10-20-11)7-8-17-15(19)6-5-12-3-2-4-13(16)9-12/h2-6,9-10H,7-8,16H2,1H3,(H,17,19)/b6-5+ |
| InChIKey | SEMKDAQWMYCHJS-AATRIKPKSA-N |
| XLogP | 2.41 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|