C11H14N2O — CID 39238221
(E)-3-(3-aminophenyl)-N-ethylprop-2-enamide (PubChem CID 39238221) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is (E)-3-(3-aminophenyl)-N-ethylprop-2-enamide.
| Compound Name | (E)-3-(3-aminophenyl)-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 39238221 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (E)-3-(3-aminophenyl)-N-ethylprop-2-enamide |
| SMILES | CCNC(=O)/C=C/c1cccc(N)c1 |
| InChI | InChI=1S/C11H14N2O/c1-2-13-11(14)7-6-9-4-3-5-10(12)8-9/h3-8H,2,12H2,1H3,(H,13,14)/b7-6+ |
| InChIKey | DRSCGTCERGZIDB-VOTSOKGWSA-N |
| XLogP | 1.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|