C16H16N2O2 — CID 114332120
(E)-3-(3-aminophenyl)-N-[(4-hydroxyphenyl)methyl]prop-2-enamide (PubChem CID 114332120) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is (E)-3-(3-aminophenyl)-N-[(4-hydroxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-aminophenyl)-N-[(4-hydroxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 114332120 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (E)-3-(3-aminophenyl)-N-[(4-hydroxyphenyl)methyl]prop-2-enamide |
| SMILES | Nc1cccc(/C=C/C(=O)NCc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C16H16N2O2/c17-14-3-1-2-12(10-14)6-9-16(20)18-11-13-4-7-15(19)8-5-13/h1-10,19H,11,17H2,(H,18,20)/b9-6+ |
| InChIKey | FABUSKKLPDFREI-RMKNXTFCSA-N |
| XLogP | 2.30 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|