C12H16N2O3 — CID 115344489
(E)-3-(3-aminophenyl)-N-(2,3-dihydroxypropyl)prop-2-enamide (PubChem CID 115344489) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is (E)-3-(3-aminophenyl)-N-(2,3-dihydroxypropyl)prop-2-enamide.
| Compound Name | (E)-3-(3-aminophenyl)-N-(2,3-dihydroxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 115344489 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (E)-3-(3-aminophenyl)-N-(2,3-dihydroxypropyl)prop-2-enamide |
| SMILES | Nc1cccc(/C=C/C(=O)NCC(O)CO)c1 |
| InChI | InChI=1S/C12H16N2O3/c13-10-3-1-2-9(6-10)4-5-12(17)14-7-11(16)8-15/h1-6,11,15-16H,7-8,13H2,(H,14,17)/b5-4+ |
| InChIKey | VMHKDMIHVPEIDQ-SNAWJCMRSA-N |
| XLogP | -0.25 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|