C12H15NO3 — CID 92526146
(Z)-N-[(2R)-2,3-dihydroxypropyl]-3-phenylprop-2-enamide (PubChem CID 92526146) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is (Z)-N-[(2R)-2,3-dihydroxypropyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[(2R)-2,3-dihydroxypropyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 92526146 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (Z)-N-[(2R)-2,3-dihydroxypropyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C\c1ccccc1)NC[C@@H](O)CO |
| InChI | InChI=1S/C12H15NO3/c14-9-11(15)8-13-12(16)7-6-10-4-2-1-3-5-10/h1-7,11,14-15H,8-9H2,(H,13,16)/b7-6-/t11-/m1/s1 |
| InChIKey | YTKHFZPEWKKYQC-JMEBYUIHSA-N |
| XLogP | 0.17 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|