C13H17N7O — CID 171139386
3-(2-aminopyrimidin-5-yl)-N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide (PubChem CID 171139386) has the molecular formula C13H17N7O and a molecular weight of 287.33 g/mol. Its IUPAC name is 3-(2-aminopyrimidin-5-yl)-N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide.
| Compound Name | 3-(2-aminopyrimidin-5-yl)-N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171139386 |
| Molecular Formula | C13H17N7O |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3-(2-aminopyrimidin-5-yl)-N-[2-(4-ethyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide |
| SMILES | CCn1cnnc1CCNC(=O)C=Cc1cnc(N)nc1 |
| InChI | InChI=1S/C13H17N7O/c1-2-20-9-18-19-11(20)5-6-15-12(21)4-3-10-7-16-13(14)17-8-10/h3-4,7-9H,2,5-6H2,1H3,(H,15,21)(H2,14,16,17) |
| InChIKey | FCGCLUZBDDAWJW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|