C17H21N5O3S — CID 131924333
(E)-3-(2-aminopyrimidin-5-yl)-N-[3-[(4-methylphenyl)sulfonylamino]propyl]prop-2-enamide (PubChem CID 131924333) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is (E)-3-(2-aminopyrimidin-5-yl)-N-[3-[(4-methylphenyl)sulfonylamino]propyl]prop-2-enamide.
| Compound Name | (E)-3-(2-aminopyrimidin-5-yl)-N-[3-[(4-methylphenyl)sulfonylamino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 131924333 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (E)-3-(2-aminopyrimidin-5-yl)-N-[3-[(4-methylphenyl)sulfonylamino]propyl]prop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCNC(=O)/C=C/c2cnc(N)nc2)cc1 |
| InChI | InChI=1S/C17H21N5O3S/c1-13-3-6-15(7-4-13)26(24,25)22-10-2-9-19-16(23)8-5-14-11-20-17(18)21-12-14/h3-8,11-12,22H,2,9-10H2,1H3,(H,19,23)(H2,18,20,21)/b8-5+ |
| InChIKey | PRFCAFRSRVRAHX-VMPITWQZSA-N |
| XLogP | 0.87 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|