C15H19N3O4S — CID 74245279
5-methyl-N-[3-[(4-methylphenyl)sulfonylamino]propyl]-1,3-oxazole-4-carboxamide (PubChem CID 74245279) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is 5-methyl-N-[3-[(4-methylphenyl)sulfonylamino]propyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 5-methyl-N-[3-[(4-methylphenyl)sulfonylamino]propyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 74245279 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 5-methyl-N-[3-[(4-methylphenyl)sulfonylamino]propyl]-1,3-oxazole-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCNC(=O)c2ncoc2C)cc1 |
| InChI | InChI=1S/C15H19N3O4S/c1-11-4-6-13(7-5-11)23(20,21)18-9-3-8-16-15(19)14-12(2)22-10-17-14/h4-7,10,18H,3,8-9H2,1-2H3,(H,16,19) |
| InChIKey | NSKXWOVBXJLCKP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|