C20H27ClN4O3S — CID 33426890
(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]prop-2-enamide (PubChem CID 33426890) has the molecular formula C20H27ClN4O3S and a molecular weight of 438.98 g/mol. Its IUPAC name is (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 33426890 |
| Molecular Formula | C20H27ClN4O3S |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]prop-2-enamide |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)NCCNS(=O)(=O)c2ccc(C)cc2)c1Cl |
| InChI | InChI=1S/C20H27ClN4O3S/c1-4-5-14-25-20(21)18(16(3)24-25)10-11-19(26)22-12-13-23-29(27,28)17-8-6-15(2)7-9-17/h6-11,23H,4-5,12-14H2,1-3H3,(H,22,26)/b11-10+ |
| InChIKey | BEAVZXDKIXOZHD-ZHACJKMWSA-N |
| XLogP | 3.06 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|