C21H35ClN4O — CID 55716734
(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[4-(4-methylpiperidin-1-yl)butyl]prop-2-enamide (PubChem CID 55716734) has the molecular formula C21H35ClN4O and a molecular weight of 394.99 g/mol. Its IUPAC name is (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[4-(4-methylpiperidin-1-yl)butyl]prop-2-enamide.
| Compound Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[4-(4-methylpiperidin-1-yl)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 55716734 |
| Molecular Formula | C21H35ClN4O |
| Molecular Weight | 394.99 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[4-(4-methylpiperidin-1-yl)butyl]prop-2-enamide |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)NCCCCN2CCC(C)CC2)c1Cl |
| InChI | InChI=1S/C21H35ClN4O/c1-4-5-14-26-21(22)19(18(3)24-26)8-9-20(27)23-12-6-7-13-25-15-10-17(2)11-16-25/h8-9,17H,4-7,10-16H2,1-3H3,(H,23,27)/b9-8+ |
| InChIKey | IFQRSRSYBNXVAZ-CMDGGOBGSA-N |
| XLogP | 4.29 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.99 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|