C21H30ClN4O+ — CID 9069379
[2-[[[(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]amino]methyl]phenyl]methyl-dimethylazanium (PubChem CID 9069379) has the molecular formula C21H30ClN4O+ and a molecular weight of 389.95 g/mol. Its IUPAC name is [2-[[[(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]amino]methyl]phenyl]methyl-dimethylazanium.
| Compound Name | [2-[[[(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]amino]methyl]phenyl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 9069379 |
| Molecular Formula | C21H30ClN4O+ |
| Molecular Weight | 389.95 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | [2-[[[(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]amino]methyl]phenyl]methyl-dimethylazanium |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)NCc2ccccc2C[NH+](C)C)c1Cl |
| InChI | InChI=1S/C21H29ClN4O/c1-5-6-13-26-21(22)19(16(2)24-26)11-12-20(27)23-14-17-9-7-8-10-18(17)15-25(3)4/h7-12H,5-6,13-15H2,1-4H3,(H,23,27)/p+1/b12-11+ |
| InChIKey | VQONAFWWVQZTSL-VAWYXSNFSA-O |
| XLogP | 2.62 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.95 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|