C23H31ClN4O — CID 36842556
(E)-N-(1-benzylpiperidin-4-yl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enamide (PubChem CID 36842556) has the molecular formula C23H31ClN4O and a molecular weight of 414.98 g/mol. Its IUPAC name is (E)-N-(1-benzylpiperidin-4-yl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(1-benzylpiperidin-4-yl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 36842556 |
| Molecular Formula | C23H31ClN4O |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | (E)-N-(1-benzylpiperidin-4-yl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enamide |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)NC2CCN(Cc3ccccc3)CC2)c1Cl |
| InChI | InChI=1S/C23H31ClN4O/c1-3-4-14-28-23(24)21(18(2)26-28)10-11-22(29)25-20-12-15-27(16-13-20)17-19-8-6-5-7-9-19/h5-11,20H,3-4,12-17H2,1-2H3,(H,25,29)/b11-10+ |
| InChIKey | MDTYVYRDYNPOGR-ZHACJKMWSA-N |
| XLogP | 4.44 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|