C20H32ClN3O2 — CID 91943983
3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-(2-methylpropyl)oxan-4-yl]prop-2-enamide (PubChem CID 91943983) has the molecular formula C20H32ClN3O2 and a molecular weight of 381.95 g/mol. Its IUPAC name is 3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-(2-methylpropyl)oxan-4-yl]prop-2-enamide.
| Compound Name | 3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-(2-methylpropyl)oxan-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 91943983 |
| Molecular Formula | C20H32ClN3O2 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-(2-methylpropyl)oxan-4-yl]prop-2-enamide |
| SMILES | CCCCn1nc(C)c(C=CC(=O)NC2CCOC(CC(C)C)C2)c1Cl |
| InChI | InChI=1S/C20H32ClN3O2/c1-5-6-10-24-20(21)18(15(4)23-24)7-8-19(25)22-16-9-11-26-17(13-16)12-14(2)3/h7-8,14,16-17H,5-6,9-13H2,1-4H3,(H,22,25) |
| InChIKey | NYXAFAYCJBDPBN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|