C23H31ClN4O — CID 55461453
(E)-1-(4-benzyl-1,4-diazepan-1-yl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 55461453) has the molecular formula C23H31ClN4O and a molecular weight of 414.98 g/mol. Its IUPAC name is (E)-1-(4-benzyl-1,4-diazepan-1-yl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-benzyl-1,4-diazepan-1-yl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55461453 |
| Molecular Formula | C23H31ClN4O |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | (E)-1-(4-benzyl-1,4-diazepan-1-yl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)N2CCCN(Cc3ccccc3)CC2)c1Cl |
| InChI | InChI=1S/C23H31ClN4O/c1-3-4-15-28-23(24)21(19(2)25-28)11-12-22(29)27-14-8-13-26(16-17-27)18-20-9-6-5-7-10-20/h5-7,9-12H,3-4,8,13-18H2,1-2H3/b12-11+ |
| InChIKey | ZMYSYVLTPNWOOE-VAWYXSNFSA-N |
| XLogP | 4.39 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|