C19H25ClN6O — CID 9082737
(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-1-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 9082737) has the molecular formula C19H25ClN6O and a molecular weight of 388.90 g/mol. Its IUPAC name is (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-1-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-1-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9082737 |
| Molecular Formula | C19H25ClN6O |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-1-(4-pyrimidin-2-ylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)N2CCN(c3ncccn3)CC2)c1Cl |
| InChI | InChI=1S/C19H25ClN6O/c1-3-4-10-26-18(20)16(15(2)23-26)6-7-17(27)24-11-13-25(14-12-24)19-21-8-5-9-22-19/h5-9H,3-4,10-14H2,1-2H3/b7-6+ |
| InChIKey | WPAWHLXQKNKSGI-VOTSOKGWSA-N |
| XLogP | 2.80 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|