C18H21ClN2O3 — CID 76857996
(2-methoxyphenyl) 3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate (PubChem CID 76857996) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is (2-methoxyphenyl) 3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate.
| Compound Name | (2-methoxyphenyl) 3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 76857996 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (2-methoxyphenyl) 3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
| SMILES | CCCCn1nc(C)c(C=CC(=O)Oc2ccccc2OC)c1Cl |
| InChI | InChI=1S/C18H21ClN2O3/c1-4-5-12-21-18(19)14(13(2)20-21)10-11-17(22)24-16-9-7-6-8-15(16)23-3/h6-11H,4-5,12H2,1-3H3 |
| InChIKey | WDNSLVWRASAUIV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|