C20H27ClN4O4S — CID 43000050
(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]prop-2-enamide (PubChem CID 43000050) has the molecular formula C20H27ClN4O4S and a molecular weight of 454.98 g/mol. Its IUPAC name is (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 43000050 |
| Molecular Formula | C20H27ClN4O4S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]prop-2-enamide |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)Nc2cc(S(=O)(=O)N(C)C)ccc2OC)c1Cl |
| InChI | InChI=1S/C20H27ClN4O4S/c1-6-7-12-25-20(21)16(14(2)23-25)9-11-19(26)22-17-13-15(8-10-18(17)29-5)30(27,28)24(3)4/h8-11,13H,6-7,12H2,1-5H3,(H,22,26)/b11-9+ |
| InChIKey | RGRXQIOBHNTOCD-PKNBQFBNSA-N |
| XLogP | 3.56 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|