C23H32ClN5O — CID 39737858
(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 39737858) has the molecular formula C23H32ClN5O and a molecular weight of 430.00 g/mol. Its IUPAC name is (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 39737858 |
| Molecular Formula | C23H32ClN5O |
| Molecular Weight | 430.00 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)Nc2ccccc2N2CCN(CC)CC2)c1Cl |
| InChI | InChI=1S/C23H32ClN5O/c1-4-6-13-29-23(24)19(18(3)26-29)11-12-22(30)25-20-9-7-8-10-21(20)28-16-14-27(5-2)15-17-28/h7-12H,4-6,13-17H2,1-3H3,(H,25,30)/b12-11+ |
| InChIKey | BUYUSBVWZRRBCN-VAWYXSNFSA-N |
| XLogP | 4.44 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.00 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|