C18H20ClN3O3 — CID 8869941
(E)-N-(1,3-benzodioxol-5-yl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enamide (PubChem CID 8869941) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-yl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-yl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 8869941 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-yl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enamide |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)Nc2ccc3c(c2)OCO3)c1Cl |
| InChI | InChI=1S/C18H20ClN3O3/c1-3-4-9-22-18(19)14(12(2)21-22)6-8-17(23)20-13-5-7-15-16(10-13)25-11-24-15/h5-8,10H,3-4,9,11H2,1-2H3,(H,20,23)/b8-6+ |
| InChIKey | XJQQZHJZGHDYRI-SOFGYWHQSA-N |
| XLogP | 4.03 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|