C20H23ClN4O4 — CID 8987117
[2-oxo-2-(phenylcarbamoylamino)ethyl] (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate (PubChem CID 8987117) has the molecular formula C20H23ClN4O4 and a molecular weight of 418.88 g/mol. Its IUPAC name is [2-oxo-2-(phenylcarbamoylamino)ethyl] (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(phenylcarbamoylamino)ethyl] (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8987117 |
| Molecular Formula | C20H23ClN4O4 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | [2-oxo-2-(phenylcarbamoylamino)ethyl] (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)OCC(=O)NC(=O)Nc2ccccc2)c1Cl |
| InChI | InChI=1S/C20H23ClN4O4/c1-3-4-12-25-19(21)16(14(2)24-25)10-11-18(27)29-13-17(26)23-20(28)22-15-8-6-5-7-9-15/h5-11H,3-4,12-13H2,1-2H3,(H2,22,23,26,28)/b11-10+ |
| InChIKey | OCFRZNQQNPORMS-ZHACJKMWSA-N |
| XLogP | 3.55 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|