C17H18ClN3O3 — CID 42327976
[2-(4-methylanilino)-2-oxoethyl] (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate (PubChem CID 42327976) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 42327976 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)/C=C/c2c(C)nn(C)c2Cl)cc1 |
| InChI | InChI=1S/C17H18ClN3O3/c1-11-4-6-13(7-5-11)19-15(22)10-24-16(23)9-8-14-12(2)20-21(3)17(14)18/h4-9H,10H2,1-3H3,(H,19,22)/b9-8+ |
| InChIKey | YGLJRLWDDPNXPE-CMDGGOBGSA-N |
| XLogP | 2.89 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|