C15H13Cl3N2O2 — CID 43040848
(3,4-dichlorophenyl)methyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate (PubChem CID 43040848) has the molecular formula C15H13Cl3N2O2 and a molecular weight of 359.64 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate.
| Compound Name | (3,4-dichlorophenyl)methyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 43040848 |
| Molecular Formula | C15H13Cl3N2O2 |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | (3,4-dichlorophenyl)methyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(C)c(Cl)c1/C=C/C(=O)OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl3N2O2/c1-9-11(15(18)20(2)19-9)4-6-14(21)22-8-10-3-5-12(16)13(17)7-10/h3-7H,8H2,1-2H3/b6-4+ |
| InChIKey | KWVFCTLHFJPCGX-GQCTYLIASA-N |
| XLogP | 4.45 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|