C12H17ClN2O2 — CID 112725037
butyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate (PubChem CID 112725037) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is butyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate.
| Compound Name | butyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 112725037 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | butyl (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C12H17ClN2O2/c1-4-5-8-17-11(16)7-6-10-9(2)14-15(3)12(10)13/h6-7H,4-5,8H2,1-3H3/b7-6+ |
| InChIKey | CPEBFVTUMUAEPF-VOTSOKGWSA-N |
| XLogP | 2.74 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|