C15H14ClN3O4S — CID 46545064
[2-oxo-2-(thiophene-2-carbonylamino)ethyl] (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate (PubChem CID 46545064) has the molecular formula C15H14ClN3O4S and a molecular weight of 367.81 g/mol. Its IUPAC name is [2-oxo-2-(thiophene-2-carbonylamino)ethyl] (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 46545064 |
| Molecular Formula | C15H14ClN3O4S |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(C)c(Cl)c1/C=C/C(=O)OCC(=O)NC(=O)c1cccs1 |
| InChI | InChI=1S/C15H14ClN3O4S/c1-9-10(14(16)19(2)18-9)5-6-13(21)23-8-12(20)17-15(22)11-4-3-7-24-11/h3-7H,8H2,1-2H3,(H,17,20,22)/b6-5+ |
| InChIKey | MBFILHSRXQZOQN-AATRIKPKSA-N |
| XLogP | 1.96 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|