C18H16Cl3N3O4 — CID 4841533
(2-acetamido-2-oxoethyl) 3-[5-chloro-1-[(2,6-dichlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 4841533) has the molecular formula C18H16Cl3N3O4 and a molecular weight of 444.70 g/mol. Its IUPAC name is (2-acetamido-2-oxoethyl) 3-[5-chloro-1-[(2,6-dichlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | (2-acetamido-2-oxoethyl) 3-[5-chloro-1-[(2,6-dichlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 4841533 |
| Molecular Formula | C18H16Cl3N3O4 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | (2-acetamido-2-oxoethyl) 3-[5-chloro-1-[(2,6-dichlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | CC(=O)NC(=O)COC(=O)C=Cc1c(C)nn(Cc2c(Cl)cccc2Cl)c1Cl |
| InChI | InChI=1S/C18H16Cl3N3O4/c1-10-12(6-7-17(27)28-9-16(26)22-11(2)25)18(21)24(23-10)8-13-14(19)4-3-5-15(13)20/h3-7H,8-9H2,1-2H3,(H,22,25,26) |
| InChIKey | WYSSXHPTNHEGMX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|