C22H20Cl2N4O4S — CID 2440314
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] (E)-3-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-enoate (PubChem CID 2440314) has the molecular formula C22H20Cl2N4O4S and a molecular weight of 507.40 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] (E)-3-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] (E)-3-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 2440314 |
| Molecular Formula | C22H20Cl2N4O4S |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] (E)-3-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(Cc2c(Cl)cccc2Cl)c(C)c1/C=C/C(=O)OCC(=O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C22H20Cl2N4O4S/c1-13-15(14(2)28(27-13)11-16-17(23)5-3-6-18(16)24)8-9-21(30)32-12-20(29)25-26-22(31)19-7-4-10-33-19/h3-10H,11-12H2,1-2H3,(H,25,29)(H,26,31)/b9-8+ |
| InChIKey | DZDVSSVKTYQKTO-CMDGGOBGSA-N |
| XLogP | 3.93 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|