C27H28Cl2N4O4 — CID 2551830
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] (E)-3-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-enoate (PubChem CID 2551830) has the molecular formula C27H28Cl2N4O4 and a molecular weight of 543.45 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] (E)-3-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] (E)-3-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 2551830 |
| Molecular Formula | C27H28Cl2N4O4 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] (E)-3-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(Cc2c(Cl)cccc2Cl)c(C)c1/C=C/C(=O)OCC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H28Cl2N4O4/c1-18-22(19(2)33(31-18)16-23-24(28)4-3-5-25(23)29)10-11-27(35)37-17-26(34)30-20-6-8-21(9-7-20)32-12-14-36-15-13-32/h3-11H,12-17H2,1-2H3,(H,30,34)/b11-10+ |
| InChIKey | BMTJAEWFTWOHRD-ZHACJKMWSA-N |
| XLogP | 4.89 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|