C19H21N3O4S — CID 55488112
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] (E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate (PubChem CID 55488112) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] (E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] (E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55488112 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] (E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate |
| SMILES | Cc1nc(/C=C/C(=O)OCC(=O)Nc2ccc(N3CCOCC3)cc2)cs1 |
| InChI | InChI=1S/C19H21N3O4S/c1-14-20-16(13-27-14)4-7-19(24)26-12-18(23)21-15-2-5-17(6-3-15)22-8-10-25-11-9-22/h2-7,13H,8-12H2,1H3,(H,21,23)/b7-4+ |
| InChIKey | OOOHSLWFAZQDGM-QPJJXVBHSA-N |
| XLogP | 2.48 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|