C17H18BrN3O2S — CID 55494282
(E)-N-(5-bromo-2-morpholin-4-ylphenyl)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 55494282) has the molecular formula C17H18BrN3O2S and a molecular weight of 408.32 g/mol. Its IUPAC name is (E)-N-(5-bromo-2-morpholin-4-ylphenyl)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(5-bromo-2-morpholin-4-ylphenyl)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55494282 |
| Molecular Formula | C17H18BrN3O2S |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | (E)-N-(5-bromo-2-morpholin-4-ylphenyl)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | Cc1nc(/C=C/C(=O)Nc2cc(Br)ccc2N2CCOCC2)cs1 |
| InChI | InChI=1S/C17H18BrN3O2S/c1-12-19-14(11-24-12)3-5-17(22)20-15-10-13(18)2-4-16(15)21-6-8-23-9-7-21/h2-5,10-11H,6-9H2,1H3,(H,20,22)/b5-3+ |
| InChIKey | CEQUACBKZISATQ-HWKANZROSA-N |
| XLogP | 3.70 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|