C15H13BrN4OS2 — CID 16617123
(E)-N-[2-[(4-bromothiophen-2-yl)methyl]pyrazol-3-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 16617123) has the molecular formula C15H13BrN4OS2 and a molecular weight of 409.33 g/mol. Its IUPAC name is (E)-N-[2-[(4-bromothiophen-2-yl)methyl]pyrazol-3-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-[(4-bromothiophen-2-yl)methyl]pyrazol-3-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 16617123 |
| Molecular Formula | C15H13BrN4OS2 |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | (E)-N-[2-[(4-bromothiophen-2-yl)methyl]pyrazol-3-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | Cc1nc(/C=C/C(=O)Nc2ccnn2Cc2cc(Br)cs2)cs1 |
| InChI | InChI=1S/C15H13BrN4OS2/c1-10-18-12(9-22-10)2-3-15(21)19-14-4-5-17-20(14)7-13-6-11(16)8-23-13/h2-6,8-9H,7H2,1H3,(H,19,21)/b3-2+ |
| InChIKey | SBEOMDAAZJILJM-NSCUHMNNSA-N |
| XLogP | 4.17 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|